C11H22O2 — CID 135060296
trans-(2R,3R)-2,3-ditert-butylcyclopropane-1,1-diol (PubChem CID 135060296) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is trans-(2R,3R)-2,3-ditert-butylcyclopropane-1,1-diol.
| Compound Name | trans-(2R,3R)-2,3-ditert-butylcyclopropane-1,1-diol |
|---|---|
| PubChem CID | 135060296 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | trans-(2R,3R)-2,3-ditert-butylcyclopropane-1,1-diol |
| SMILES | CC(C)(C)[C@H]1[C@H](C(C)(C)C)C1(O)O |
| InChI | InChI=1S/C11H22O2/c1-9(2,3)7-8(10(4,5)6)11(7,12)13/h7-8,12-13H,1-6H3/t7-,8-/m1/s1 |
| InChIKey | NCUQKEBYEFTSGM-HTQZYQBOSA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|