C28H32N2O3 — CID 162400193
ethyl (E)-3-[2-[[(E)-3-(1-benzyl-3-ethyl-2-oxopiperidin-3-yl)prop-2-enylidene]amino]phenyl]prop-2-enoate (PubChem CID 162400193) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[(E)-3-(1-benzyl-3-ethyl-2-oxopiperidin-3-yl)prop-2-enylidene]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[(E)-3-(1-benzyl-3-ethyl-2-oxopiperidin-3-yl)prop-2-enylidene]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162400193 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethyl (E)-3-[2-[[(E)-3-(1-benzyl-3-ethyl-2-oxopiperidin-3-yl)prop-2-enylidene]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccccc1/N=C/C=C/C1(CC)CCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H32N2O3/c1-3-28(19-11-21-30(27(28)32)22-23-12-6-5-7-13-23)18-10-20-29-25-15-9-8-14-24(25)16-17-26(31)33-4-2/h5-10,12-18,20H,3-4,11,19,21-22H2,1-2H3/b17-16+,18-10+,29-20+ |
| InChIKey | ZBIYEPTZGOUXOK-JSDPIAGBSA-N |
| XLogP | 5.74 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|