About dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium
dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium (PubChem CID 162401208) has the molecular formula C22H18NO5Pd-
and a molecular weight of 482.81 g/mol. Its IUPAC name is dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium.
Molecular Properties
| Compound Name | dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium |
| PubChem CID | 162401208 |
| Molecular Formula | C22H18NO5Pd- |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium |
| SMILES | COC(=O)/[C-]=C(\C(=O)OC)c1cc(=O)n(Cc2ccccc2)c2ccccc12.[Pd] |
| InChI | InChI=1S/C22H18NO5.Pd/c1-27-21(25)13-18(22(26)28-2)17-12-20(24)23(14-15-8-4-3-5-9-15)19-11-7-6-10-16(17)19;/h3-12H,14H2,1-2H3;/q-1; |
| InChIKey | AFHBKAVJGYDZNW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium?
The IUPAC name of dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium (CID 162401208) is dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium.
What is the SMILES notation for dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium?
The canonical SMILES for dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium is COC(=O)/[C-]=C(\C(=O)OC)c1cc(=O)n(Cc2ccccc2)c2ccccc12.[Pd].
What is the InChIKey of dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium?
The InChIKey is AFHBKAVJGYDZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18NO5.Pd/c1-27-21(25)13-18(22(26)28-2)17-12-20(24)23(14-15-8-4-3-5-9-15)19-11-7-6-10-16(17)19;/h3-12H,14H2,1-2H3;/q-1;.
What are the key properties of dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium?
dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium has a molecular weight of 482.81 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(1-benzyl-2-oxoquinolin-4-yl)but-2-enedioate;palladium is sourced from PubChem (CID 162401208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).