C37H40FNO3 — CID 162401793
(2R,3R,4S,5S,6R)-1-benzyl-5-fluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylpiperidine (PubChem CID 162401793) has the molecular formula C37H40FNO3 and a molecular weight of 565.73 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-1-benzyl-5-fluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylpiperidine.
| Compound Name | (2R,3R,4S,5S,6R)-1-benzyl-5-fluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 162401793 |
| Molecular Formula | C37H40FNO3 |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | (2R,3R,4S,5S,6R)-1-benzyl-5-fluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enylpiperidine |
| SMILES | C=CC[C@@H]1[C@H](F)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C37H40FNO3/c1-2-15-33-35(38)37(42-27-32-22-13-6-14-23-32)36(41-26-31-20-11-5-12-21-31)34(28-40-25-30-18-9-4-10-19-30)39(33)24-29-16-7-3-8-17-29/h2-14,16-23,33-37H,1,15,24-28H2/t33-,34-,35+,36-,37-/m1/s1 |
| InChIKey | GGZUHPRERQYBNO-KHKVHWIZSA-N |
| XLogP | 7.54 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|