C18H13ClN4 — CID 162402105
1-(3-chlorophenyl)-N-phenylpyrazolo[5,4-b]pyridin-3-amine (PubChem CID 162402105) has the molecular formula C18H13ClN4 and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-phenylpyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | 1-(3-chlorophenyl)-N-phenylpyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 162402105 |
| Molecular Formula | C18H13ClN4 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-phenylpyrazolo[5,4-b]pyridin-3-amine |
| SMILES | Clc1cccc(-n2nc(Nc3ccccc3)c3cccnc32)c1 |
| InChI | InChI=1S/C18H13ClN4/c19-13-6-4-9-15(12-13)23-18-16(10-5-11-20-18)17(22-23)21-14-7-2-1-3-8-14/h1-12H,(H,21,22) |
| InChIKey | DKRULDAYJWZGJN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |