C20H15N3O — CID 141067621
2-anilino-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 141067621) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-anilino-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 141067621 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-anilino-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C20H15N3O/c24-18-14-19(22-15-8-3-1-4-9-15)23(16-10-5-2-6-11-16)20-17(18)12-7-13-21-20/h1-14,22H |
| InChIKey | AQBGAWBFTWADRS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |