C26H20N4O — CID 20790469
2,8-dianilino-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 20790469) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is 2,8-dianilino-1-phenyl-1,6-naphthyridin-4-one.
| Compound Name | 2,8-dianilino-1-phenyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790469 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2,8-dianilino-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2c(Nc3ccccc3)cncc12 |
| InChI | InChI=1S/C26H20N4O/c31-24-16-25(29-20-12-6-2-7-13-20)30(21-14-8-3-9-15-21)26-22(24)17-27-18-23(26)28-19-10-4-1-5-11-19/h1-18,28-29H |
| InChIKey | AHCKARPLSPUCFR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |