C20H16N4O — CID 58589534
5-amino-2-anilino-1-phenyl-1,7-naphthyridin-4-one (PubChem CID 58589534) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is 5-amino-2-anilino-1-phenyl-1,7-naphthyridin-4-one.
| Compound Name | 5-amino-2-anilino-1-phenyl-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 58589534 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-amino-2-anilino-1-phenyl-1,7-naphthyridin-4-one |
| SMILES | Nc1cncc2c1c(=O)cc(Nc1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C20H16N4O/c21-16-12-22-13-17-20(16)18(25)11-19(23-14-7-3-1-4-8-14)24(17)15-9-5-2-6-10-15/h1-13,23H,21H2 |
| InChIKey | HEJWVMVKJOEZRO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |