C21H17N3O2 — CID 58589526
2-anilino-1-(3-methoxyphenyl)-1,7-naphthyridin-4-one (PubChem CID 58589526) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-anilino-1-(3-methoxyphenyl)-1,7-naphthyridin-4-one.
| Compound Name | 2-anilino-1-(3-methoxyphenyl)-1,7-naphthyridin-4-one |
|---|---|
| PubChem CID | 58589526 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-anilino-1-(3-methoxyphenyl)-1,7-naphthyridin-4-one |
| SMILES | COc1cccc(-n2c(Nc3ccccc3)cc(=O)c3ccncc32)c1 |
| InChI | InChI=1S/C21H17N3O2/c1-26-17-9-5-8-16(12-17)24-19-14-22-11-10-18(19)20(25)13-21(24)23-15-6-3-2-4-7-15/h2-14,23H,1H3 |
| InChIKey | OQQPZDVPNFGYGP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |