About 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one
2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 20790696) has the molecular formula C28H23N3O3
and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one |
| PubChem CID | 20790696 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | COc1ccc(OCc2cc3c(cn2)c(=O)cc(Nc2ccccc2)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-33-23-12-14-24(15-13-23)34-19-21-16-26-25(18-29-21)27(32)17-28(30-20-8-4-2-5-9-20)31(26)22-10-6-3-7-11-22/h2-18,30H,19H2,1H3 |
| InChIKey | IKQHMTDFUFPFGQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one?
The IUPAC name of 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one (CID 20790696) is 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one.
What is the SMILES notation for 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one?
The canonical SMILES for 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one is COc1ccc(OCc2cc3c(cn2)c(=O)cc(Nc2ccccc2)n3-c2ccccc2)cc1.
What is the InChIKey of 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one?
The InChIKey is IKQHMTDFUFPFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23N3O3/c1-33-23-12-14-24(15-13-23)34-19-21-16-26-25(18-29-21)27(32)17-28(30-20-8-4-2-5-9-20)31(26)22-10-6-3-7-11-22/h2-18,30H,19H2,1H3.
What are the key properties of 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one?
2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one has a molecular weight of 449.51 g/mol, XLogP of 5.72, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-7-[(4-methoxyphenoxy)methyl]-1-phenyl-1,6-naphthyridin-4-one is sourced from PubChem (CID 20790696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).