C31H27N5O2 — CID 20790675
2-anilino-7-(4-benzoylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 20790675) has the molecular formula C31H27N5O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-anilino-7-(4-benzoylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one.
| Compound Name | 2-anilino-7-(4-benzoylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790675 |
| Molecular Formula | C31H27N5O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2-anilino-7-(4-benzoylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | O=C(c1ccccc1)N1CCN(c2cc3c(cn2)c(=O)cc(Nc2ccccc2)n3-c2ccccc2)CC1 |
| InChI | InChI=1S/C31H27N5O2/c37-28-21-30(33-24-12-6-2-7-13-24)36(25-14-8-3-9-15-25)27-20-29(32-22-26(27)28)34-16-18-35(19-17-34)31(38)23-10-4-1-5-11-23/h1-15,20-22,33H,16-19H2 |
| InChIKey | RLRGJWPQJQDWOO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |