C13H11N3OS — CID 79296550
1-(3-methoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 79296550) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1-(3-methoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 79296550 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-(3-methoxyphenyl)-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | COc1cccc(-n2c(=S)[nH]c3cnccc32)c1 |
| InChI | InChI=1S/C13H11N3OS/c1-17-10-4-2-3-9(7-10)16-12-5-6-14-8-11(12)15-13(16)18/h2-8H,1H3,(H,15,18) |
| InChIKey | WQRVDJWOVRMKET-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|