C25H25N5O3S — CID 20790890
2-anilino-8-(4-methylsulfonylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 20790890) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-anilino-8-(4-methylsulfonylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one.
| Compound Name | 2-anilino-8-(4-methylsulfonylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790890 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-anilino-8-(4-methylsulfonylpiperazin-1-yl)-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | CS(=O)(=O)N1CCN(c2cncc3c(=O)cc(Nc4ccccc4)n(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C25H25N5O3S/c1-34(32,33)29-14-12-28(13-15-29)22-18-26-17-21-23(31)16-24(27-19-8-4-2-5-9-19)30(25(21)22)20-10-6-3-7-11-20/h2-11,16-18,27H,12-15H2,1H3 |
| InChIKey | NQXZLDIIVCMGIV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |