C19H14N2O2S — CID 143009081
6-anilino-2-hydroxy-7-phenylthieno[2,3-b]pyridin-4-one (PubChem CID 143009081) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is 6-anilino-2-hydroxy-7-phenylthieno[2,3-b]pyridin-4-one.
| Compound Name | 6-anilino-2-hydroxy-7-phenylthieno[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 143009081 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-anilino-2-hydroxy-7-phenylthieno[2,3-b]pyridin-4-one |
| SMILES | O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2sc(O)cc12 |
| InChI | InChI=1S/C19H14N2O2S/c22-16-12-17(20-13-7-3-1-4-8-13)21(14-9-5-2-6-10-14)19-15(16)11-18(23)24-19/h1-12,20,23H |
| InChIKey | RROPJMPEYXWJRM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |