C19H26O8 — CID 162402951
[(E,3R,4R,5S)-4,5-diacetyloxy-6-methyl-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-1-en-3-yl] acetate (PubChem CID 162402951) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is [(E,3R,4R,5S)-4,5-diacetyloxy-6-methyl-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-1-en-3-yl] acetate.
| Compound Name | [(E,3R,4R,5S)-4,5-diacetyloxy-6-methyl-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 162402951 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [(E,3R,4R,5S)-4,5-diacetyloxy-6-methyl-1-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-1-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]([C@@H](/C=C/[C@H]1CC=CC(=O)O1)OC(C)=O)[C@@H](OC(C)=O)C(C)C |
| InChI | InChI=1S/C19H26O8/c1-11(2)18(25-13(4)21)19(26-14(5)22)16(24-12(3)20)10-9-15-7-6-8-17(23)27-15/h6,8-11,15-16,18-19H,7H2,1-5H3/b10-9+/t15-,16-,18+,19+/m1/s1 |
| InChIKey | KBQXYSHSOHGWJW-ZQMHWGRASA-N |
| XLogP | 1.87 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|