C32H31NO4S — CID 162404341
methyl 9-hexyl-21,22-dimethoxy-15-thia-9-azahexacyclo[11.11.0.02,10.03,8.014,18.019,24]tetracosa-1(13),2(10),3,5,7,11,14(18),16,19,21,23-undecaene-16-carboxylate (PubChem CID 162404341) has the molecular formula C32H31NO4S and a molecular weight of 525.67 g/mol. Its IUPAC name is methyl 9-hexyl-21,22-dimethoxy-15-thia-9-azahexacyclo[11.11.0.02,10.03,8.014,18.019,24]tetracosa-1(13),2(10),3,5,7,11,14(18),16,19,21,23-undecaene-16-carboxylate.
| Compound Name | methyl 9-hexyl-21,22-dimethoxy-15-thia-9-azahexacyclo[11.11.0.02,10.03,8.014,18.019,24]tetracosa-1(13),2(10),3,5,7,11,14(18),16,19,21,23-undecaene-16-carboxylate |
|---|---|
| PubChem CID | 162404341 |
| Molecular Formula | C32H31NO4S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | methyl 9-hexyl-21,22-dimethoxy-15-thia-9-azahexacyclo[11.11.0.02,10.03,8.014,18.019,24]tetracosa-1(13),2(10),3,5,7,11,14(18),16,19,21,23-undecaene-16-carboxylate |
| SMILES | CCCCCCn1c2ccccc2c2c3c4cc(OC)c(OC)cc4c4cc(C(=O)OC)sc4c3ccc21 |
| InChI | InChI=1S/C32H31NO4S/c1-5-6-7-10-15-33-24-12-9-8-11-19(24)30-25(33)14-13-20-29(30)22-17-27(36-3)26(35-2)16-21(22)23-18-28(32(34)37-4)38-31(20)23/h8-9,11-14,16-18H,5-7,10,15H2,1-4H3 |
| InChIKey | KTELRFHINQNUIX-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|