C17H30OSi — CID 162404506
(5R)-3-methyl-5-prop-1-en-2-yl-1-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohex-2-en-1-ol (PubChem CID 162404506) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is (5R)-3-methyl-5-prop-1-en-2-yl-1-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohex-2-en-1-ol.
| Compound Name | (5R)-3-methyl-5-prop-1-en-2-yl-1-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162404506 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (5R)-3-methyl-5-prop-1-en-2-yl-1-[2-(trimethylsilylmethyl)prop-2-enyl]cyclohex-2-en-1-ol |
| SMILES | C=C(CC1(O)C=C(C)C[C@@H](C(=C)C)C1)C[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-13(2)16-8-14(3)9-17(18,11-16)10-15(4)12-19(5,6)7/h9,16,18H,1,4,8,10-12H2,2-3,5-7H3/t16-,17?/m1/s1 |
| InChIKey | LHWLUOXCZBFKCU-TZHYSIJRSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|