C16H30OSi — CID 101398678
(1R,6S)-2-methyl-1-prop-2-enyl-6-triethylsilylcyclohex-2-en-1-ol (PubChem CID 101398678) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is (1R,6S)-2-methyl-1-prop-2-enyl-6-triethylsilylcyclohex-2-en-1-ol.
| Compound Name | (1R,6S)-2-methyl-1-prop-2-enyl-6-triethylsilylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 101398678 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (1R,6S)-2-methyl-1-prop-2-enyl-6-triethylsilylcyclohex-2-en-1-ol |
| SMILES | C=CC[C@@]1(O)C(C)=CCC[C@@H]1[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H30OSi/c1-6-13-16(17)14(5)11-10-12-15(16)18(7-2,8-3)9-4/h6,11,15,17H,1,7-10,12-13H2,2-5H3/t15-,16+/m0/s1 |
| InChIKey | GESBIXGQNQFHOB-JKSUJKDBSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|