C18H32OSi — CID 12885230
1-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclohex-2-en-1-ol (PubChem CID 12885230) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is 1-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclohex-2-en-1-ol.
| Compound Name | 1-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 12885230 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[3-tri(propan-2-yl)silylprop-2-ynyl]cyclohex-2-en-1-ol |
| SMILES | CC(C)[Si](C#CCC1(O)C=CCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H32OSi/c1-15(2)20(16(3)4,17(5)6)14-10-13-18(19)11-8-7-9-12-18/h8,11,15-17,19H,7,9,12-13H2,1-6H3 |
| InChIKey | UKSVXGWPPLKZSU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|