C10H8ClN3O2 — CID 162404582
5-methoxy-2-(triazol-2-yl)benzoyl chloride (PubChem CID 162404582) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is 5-methoxy-2-(triazol-2-yl)benzoyl chloride.
| Compound Name | 5-methoxy-2-(triazol-2-yl)benzoyl chloride |
|---|---|
| PubChem CID | 162404582 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 5-methoxy-2-(triazol-2-yl)benzoyl chloride |
| SMILES | COc1ccc(-n2nccn2)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C10H8ClN3O2/c1-16-7-2-3-9(8(6-7)10(11)15)14-12-4-5-13-14/h2-6H,1H3 |
| InChIKey | MLMYDQCBQBGTIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|