C11H13ClFNO3 — CID 174542772
N,N-dimethylformamide;2-fluoro-4-methoxybenzoyl chloride (PubChem CID 174542772) has the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. Its IUPAC name is N,N-dimethylformamide;2-fluoro-4-methoxybenzoyl chloride.
| Compound Name | N,N-dimethylformamide;2-fluoro-4-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 174542772 |
| Molecular Formula | C11H13ClFNO3 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N,N-dimethylformamide;2-fluoro-4-methoxybenzoyl chloride |
| SMILES | CN(C)C=O.COc1ccc(C(=O)Cl)c(F)c1 |
| InChI | InChI=1S/C8H6ClFO2.C3H7NO/c1-12-5-2-3-6(8(9)11)7(10)4-5;1-4(2)3-5/h2-4H,1H3;3H,1-2H3 |
| InChIKey | PDFLQNBIKFDTLL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|