C30H22F3INO3PS — CID 162404872
[[2-(4-iodophenyl)-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 162404872) has the molecular formula C30H22F3INO3PS and a molecular weight of 691.45 g/mol. Its IUPAC name is [[2-(4-iodophenyl)-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [[2-(4-iodophenyl)-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162404872 |
| Molecular Formula | C30H22F3INO3PS |
| Molecular Weight | 691.45 g/mol |
| Exact Mass | 691.01 |
| IUPAC Name | [[2-(4-iodophenyl)-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OP(c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccnc(-c2ccc(I)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C30H22F3INO3PS/c31-30(32,33)40(36,37)38-39(25-10-4-1-5-11-25,26-12-6-2-7-13-26,27-14-8-3-9-15-27)28-20-21-35-29(22-28)23-16-18-24(34)19-17-23/h1-22H |
| InChIKey | AFYWFFSWLBFOCB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|