C23H19FN2O — CID 162405258
(2R)-2-(1-ethyl-4-fluoroindazol-6-yl)-1,2-diphenylethanone (PubChem CID 162405258) has the molecular formula C23H19FN2O and a molecular weight of 358.42 g/mol. Its IUPAC name is (2R)-2-(1-ethyl-4-fluoroindazol-6-yl)-1,2-diphenylethanone.
| Compound Name | (2R)-2-(1-ethyl-4-fluoroindazol-6-yl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 162405258 |
| Molecular Formula | C23H19FN2O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2R)-2-(1-ethyl-4-fluoroindazol-6-yl)-1,2-diphenylethanone |
| SMILES | CCn1ncc2c(F)cc([C@H](C(=O)c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C23H19FN2O/c1-2-26-21-14-18(13-20(24)19(21)15-25-26)22(16-9-5-3-6-10-16)23(27)17-11-7-4-8-12-17/h3-15,22H,2H2,1H3/t22-/m1/s1 |
| InChIKey | JEDPVKCCSCQLFD-JOCHJYFZSA-N |
| XLogP | 5.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |