C31H52N4O5 — CID 162405844
ethyl (2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-methyl-4-phenylbutanoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylpentanoate (PubChem CID 162405844) has the molecular formula C31H52N4O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is ethyl (2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-methyl-4-phenylbutanoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylpentanoate.
| Compound Name | ethyl (2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-methyl-4-phenylbutanoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 162405844 |
| Molecular Formula | C31H52N4O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | ethyl (2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-3-methyl-4-phenylbutanoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylpentanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)(C)C)[C@@H](C)Cc1ccccc1)C(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C31H52N4O5/c1-11-19(3)23(29(39)40-12-2)34-28(38)25(31(8,9)10)35-26(36)22(33-27(37)24(32)30(5,6)7)20(4)18-21-16-14-13-15-17-21/h13-17,19-20,22-25H,11-12,18,32H2,1-10H3,(H,33,37)(H,34,38)(H,35,36)/t19-,20-,22-,23-,24+,25+/m0/s1 |
| InChIKey | WTTCOKIVDAIVLT-CLQDMXRCSA-N |
| XLogP | 3.35 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |