C14H23BO2 — CID 162406450
2-[(1S)-2-cyclohexa-2,4-dien-1-yl-1-deuterioethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162406450) has the molecular formula C14H23BO2 and a molecular weight of 235.15 g/mol. Its IUPAC name is 2-[(1S)-2-cyclohexa-2,4-dien-1-yl-1-deuterioethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1S)-2-cyclohexa-2,4-dien-1-yl-1-deuterioethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162406450 |
| Molecular Formula | C14H23BO2 |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-[(1S)-2-cyclohexa-2,4-dien-1-yl-1-deuterioethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H][C@H](CC1C=CC=CC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H23BO2/c1-13(2)14(3,4)17-15(16-13)11-10-12-8-6-5-7-9-12/h5-8,12H,9-11H2,1-4H3/i11D/t11-,12?/m1/s1 |
| InChIKey | WXXJXYRFAFEHQW-DDYKOQLYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|