C15H20ClN3O2 — CID 162408109
3-chloro-N-[(4E)-4-morpholin-4-yliminobutyl]benzamide (PubChem CID 162408109) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 3-chloro-N-[(4E)-4-morpholin-4-yliminobutyl]benzamide.
| Compound Name | 3-chloro-N-[(4E)-4-morpholin-4-yliminobutyl]benzamide |
|---|---|
| PubChem CID | 162408109 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-chloro-N-[(4E)-4-morpholin-4-yliminobutyl]benzamide |
| SMILES | O=C(NCCC/C=N/N1CCOCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O2/c16-14-5-3-4-13(12-14)15(20)17-6-1-2-7-18-19-8-10-21-11-9-19/h3-5,7,12H,1-2,6,8-11H2,(H,17,20)/b18-7+ |
| InChIKey | REILKYAGGOTCFO-CNHKJKLMSA-N |
| XLogP | 2.17 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|