C11H10N4O2S — CID 162408157
methyl 4-(6-methylsulfanyl-1,2,4,5-tetrazin-3-yl)benzoate (PubChem CID 162408157) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is methyl 4-(6-methylsulfanyl-1,2,4,5-tetrazin-3-yl)benzoate.
| Compound Name | methyl 4-(6-methylsulfanyl-1,2,4,5-tetrazin-3-yl)benzoate |
|---|---|
| PubChem CID | 162408157 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | methyl 4-(6-methylsulfanyl-1,2,4,5-tetrazin-3-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(SC)nn2)cc1 |
| InChI | InChI=1S/C11H10N4O2S/c1-17-10(16)8-5-3-7(4-6-8)9-12-14-11(18-2)15-13-9/h3-6H,1-2H3 |
| InChIKey | PKRNASRHONWUQP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |