C26H32O — CID 162409829
(8R,9S,13S,14S)-3-(2-cyclohexylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 162409829) has the molecular formula C26H32O and a molecular weight of 360.54 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(2-cyclohexylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(2-cyclohexylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 162409829 |
| Molecular Formula | C26H32O |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (8R,9S,13S,14S)-3-(2-cyclohexylethynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C#CC5CCCCC5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C26H32O/c1-26-16-15-22-21-11-9-19(8-7-18-5-3-2-4-6-18)17-20(21)10-12-23(22)24(26)13-14-25(26)27/h9,11,17-18,22-24H,2-6,10,12-16H2,1H3/t22-,23-,24+,26+/m1/s1 |
| InChIKey | DPZPTJPMLHGZNF-BIATYSSJSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|