C7H12O3 — CID 162409992
[(2S)-2-ethenyl-1,4-dioxan-2-yl]methanol (PubChem CID 162409992) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is [(2S)-2-ethenyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2S)-2-ethenyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 162409992 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(2S)-2-ethenyl-1,4-dioxan-2-yl]methanol |
| SMILES | C=C[C@]1(CO)COCCO1 |
| InChI | InChI=1S/C7H12O3/c1-2-7(5-8)6-9-3-4-10-7/h2,8H,1,3-6H2/t7-/m0/s1 |
| InChIKey | KRVMGYDWLUKMFC-ZETCQYMHSA-N |
| XLogP | -0.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|