C14H17F4NO4S — CID 162410198
methyl 6-[(4-fluorophenyl)sulfonylamino]-3-(trifluoromethyl)hexanoate (PubChem CID 162410198) has the molecular formula C14H17F4NO4S and a molecular weight of 371.35 g/mol. Its IUPAC name is methyl 6-[(4-fluorophenyl)sulfonylamino]-3-(trifluoromethyl)hexanoate.
| Compound Name | methyl 6-[(4-fluorophenyl)sulfonylamino]-3-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 162410198 |
| Molecular Formula | C14H17F4NO4S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | methyl 6-[(4-fluorophenyl)sulfonylamino]-3-(trifluoromethyl)hexanoate |
| SMILES | COC(=O)CC(CCCNS(=O)(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F4NO4S/c1-23-13(20)9-10(14(16,17)18)3-2-8-19-24(21,22)12-6-4-11(15)5-7-12/h4-7,10,19H,2-3,8-9H2,1H3 |
| InChIKey | JCURBMAIZVZXFV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|