C18H19N — CID 162411237
5-butyl-1-phenylindole (PubChem CID 162411237) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 5-butyl-1-phenylindole.
| Compound Name | 5-butyl-1-phenylindole |
|---|---|
| PubChem CID | 162411237 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 5-butyl-1-phenylindole |
| SMILES | CCCCc1ccc2c(ccn2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N/c1-2-3-7-15-10-11-18-16(14-15)12-13-19(18)17-8-5-4-6-9-17/h4-6,8-14H,2-3,7H2,1H3 |
| InChIKey | CORQXWRVWVMGQA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |