C10H7ClF2O — CID 162411590
1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one (PubChem CID 162411590) has the molecular formula C10H7ClF2O and a molecular weight of 216.61 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one |
|---|---|
| PubChem CID | 162411590 |
| Molecular Formula | C10H7ClF2O |
| Molecular Weight | 216.61 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one |
| SMILES | O=C(CC=C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClF2O/c11-8-3-1-7(2-4-8)9(14)5-6-10(12)13/h1-4,6H,5H2 |
| InChIKey | MNBDVNQYNRVSQW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |