About 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one
1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one (PubChem CID 162411590) has the molecular formula C10H7ClF2O
and a molecular weight of 216.61 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one |
| PubChem CID | 162411590 |
| Molecular Formula | C10H7ClF2O |
| Molecular Weight | 216.61 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one |
| SMILES | O=C(CC=C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClF2O/c11-8-3-1-7(2-4-8)9(14)5-6-10(12)13/h1-4,6H,5H2 |
| InChIKey | MNBDVNQYNRVSQW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one?
The IUPAC name of 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one (CID 162411590) is 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one.
What is the SMILES notation for 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one?
The canonical SMILES for 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one is O=C(CC=C(F)F)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one?
The InChIKey is MNBDVNQYNRVSQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClF2O/c11-8-3-1-7(2-4-8)9(14)5-6-10(12)13/h1-4,6H,5H2.
What are the key properties of 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one?
1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one has a molecular weight of 216.61 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-4,4-difluorobut-3-en-1-one is sourced from PubChem (CID 162411590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).