C21H17FNO2P — CID 162411968
(E)-N-diphenylphosphoryloxy-5-fluoro-2,3-dihydroinden-1-imine (PubChem CID 162411968) has the molecular formula C21H17FNO2P and a molecular weight of 365.34 g/mol. Its IUPAC name is (E)-N-diphenylphosphoryloxy-5-fluoro-2,3-dihydroinden-1-imine.
| Compound Name | (E)-N-diphenylphosphoryloxy-5-fluoro-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 162411968 |
| Molecular Formula | C21H17FNO2P |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (E)-N-diphenylphosphoryloxy-5-fluoro-2,3-dihydroinden-1-imine |
| SMILES | O=P(O/N=C1\CCc2cc(F)ccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17FNO2P/c22-17-12-13-20-16(15-17)11-14-21(20)23-25-26(24,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,12-13,15H,11,14H2/b23-21+ |
| InChIKey | RWGKQZCHMVXCOU-XTQSDGFTSA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|