C21H18NOP — CID 11313530
(E)-N-diphenylphosphoryl-2,3-dihydroinden-1-imine (PubChem CID 11313530) has the molecular formula C21H18NOP and a molecular weight of 331.36 g/mol. Its IUPAC name is (E)-N-diphenylphosphoryl-2,3-dihydroinden-1-imine.
| Compound Name | (E)-N-diphenylphosphoryl-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 11313530 |
| Molecular Formula | C21H18NOP |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (E)-N-diphenylphosphoryl-2,3-dihydroinden-1-imine |
| SMILES | O=P(/N=C1\CCc2ccccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18NOP/c23-24(18-10-3-1-4-11-18,19-12-5-2-6-13-19)22-21-16-15-17-9-7-8-14-20(17)21/h1-14H,15-16H2/b22-21+ |
| InChIKey | MDUBXOVBHUQRRO-QURGRASLSA-N |
| XLogP | 4.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|