C16H24O6 — CID 162411989
(1R,15R,16S,20S)-2,5,8,11,14-pentaoxatricyclo[13.6.0.016,20]henicos-17-en-19-one (PubChem CID 162411989) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (1R,15R,16S,20S)-2,5,8,11,14-pentaoxatricyclo[13.6.0.016,20]henicos-17-en-19-one.
| Compound Name | (1R,15R,16S,20S)-2,5,8,11,14-pentaoxatricyclo[13.6.0.016,20]henicos-17-en-19-one |
|---|---|
| PubChem CID | 162411989 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (1R,15R,16S,20S)-2,5,8,11,14-pentaoxatricyclo[13.6.0.016,20]henicos-17-en-19-one |
| SMILES | O=C1C=C[C@@H]2[C@H]3OCCOCCOCCOCCO[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C16H24O6/c17-14-2-1-12-13(14)11-15-16(12)22-10-8-20-6-4-18-3-5-19-7-9-21-15/h1-2,12-13,15-16H,3-11H2/t12-,13-,15+,16+/m0/s1 |
| InChIKey | HPFINUMFUJTQTA-WMHQRMGPSA-N |
| XLogP | 0.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |