C11H16O3 — CID 91513877
1,2-dimethoxy-1,2,3,3a,4,7a-hexahydroinden-5-one (PubChem CID 91513877) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1,2-dimethoxy-1,2,3,3a,4,7a-hexahydroinden-5-one.
| Compound Name | 1,2-dimethoxy-1,2,3,3a,4,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 91513877 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1,2-dimethoxy-1,2,3,3a,4,7a-hexahydroinden-5-one |
| SMILES | COC1CC2CC(=O)C=CC2C1OC |
| InChI | InChI=1S/C11H16O3/c1-13-10-6-7-5-8(12)3-4-9(7)11(10)14-2/h3-4,7,9-11H,5-6H2,1-2H3 |
| InChIKey | SFCYGGXYJNBDSK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |