C10H14O2 — CID 141050008
1-methoxy-1,2,3,3a,4,7a-hexahydroinden-5-one (PubChem CID 141050008) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-methoxy-1,2,3,3a,4,7a-hexahydroinden-5-one.
| Compound Name | 1-methoxy-1,2,3,3a,4,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 141050008 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-methoxy-1,2,3,3a,4,7a-hexahydroinden-5-one |
| SMILES | COC1CCC2CC(=O)C=CC21 |
| InChI | InChI=1S/C10H14O2/c1-12-10-5-2-7-6-8(11)3-4-9(7)10/h3-4,7,9-10H,2,5-6H2,1H3 |
| InChIKey | YPIWBMHOHJUABJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |