C12H18O2 — CID 130877557
(1S,3aS,7aS)-1-hydroxy-4,4,7a-trimethyl-1,2,3,3a-tetrahydroinden-5-one (PubChem CID 130877557) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,3aS,7aS)-1-hydroxy-4,4,7a-trimethyl-1,2,3,3a-tetrahydroinden-5-one.
| Compound Name | (1S,3aS,7aS)-1-hydroxy-4,4,7a-trimethyl-1,2,3,3a-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 130877557 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,3aS,7aS)-1-hydroxy-4,4,7a-trimethyl-1,2,3,3a-tetrahydroinden-5-one |
| SMILES | CC1(C)C(=O)C=C[C@@]2(C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C12H18O2/c1-11(2)8-4-5-10(14)12(8,3)7-6-9(11)13/h6-8,10,14H,4-5H2,1-3H3/t8-,10+,12+/m1/s1 |
| InChIKey | LTFFCXRICLLHEL-QRTLGDNMSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |