C12H18O2 — CID 10997899
(3R,3aR,6Z,9aR)-3-methoxy-1,2,3,3a,4,8,9,9a-octahydrocyclopenta[8]annulen-5-one (PubChem CID 10997899) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3R,3aR,6Z,9aR)-3-methoxy-1,2,3,3a,4,8,9,9a-octahydrocyclopenta[8]annulen-5-one.
| Compound Name | (3R,3aR,6Z,9aR)-3-methoxy-1,2,3,3a,4,8,9,9a-octahydrocyclopenta[8]annulen-5-one |
|---|---|
| PubChem CID | 10997899 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3R,3aR,6Z,9aR)-3-methoxy-1,2,3,3a,4,8,9,9a-octahydrocyclopenta[8]annulen-5-one |
| SMILES | CO[C@@H]1CC[C@H]2CC/C=C\C(=O)C[C@H]21 |
| InChI | InChI=1S/C12H18O2/c1-14-12-7-6-9-4-2-3-5-10(13)8-11(9)12/h3,5,9,11-12H,2,4,6-8H2,1H3/b5-3-/t9-,11-,12-/m1/s1 |
| InChIKey | IZIDWBCOQBQWDU-DZKLEINKSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |