About (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate
(4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate (PubChem CID 14044849) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate.
Analyze (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate?
The IUPAC name of (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate (CID 14044849) is (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate.
What is the SMILES notation for (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate?
The canonical SMILES for (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate is CC(=O)OC1CCC2C(=O)C=CC12.
What is the InChIKey of (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate?
The InChIKey is NTHGKKCXMZFSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6(11)13-10-5-3-7-8(10)2-4-9(7)12/h2,4,7-8,10H,3,5H2,1H3.
What are the key properties of (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate?
(4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate has a molecular weight of 180.20 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-2,3,3a,6a-tetrahydro-1H-pentalen-1-yl) acetate is sourced from PubChem (CID 14044849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).