C14H22O8S — CID 162412190
[(3R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate (PubChem CID 162412190) has the molecular formula C14H22O8S and a molecular weight of 350.39 g/mol. Its IUPAC name is [(3R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162412190 |
| Molecular Formula | C14H22O8S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [(3R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1O |
| InChI | InChI=1S/C14H22O8S/c1-5-23-14-11(18)13(21-9(4)17)12(20-8(3)16)10(22-14)6-19-7(2)15/h10-14,18H,5-6H2,1-4H3/t10?,11?,12-,13?,14+/m1/s1 |
| InChIKey | IZPREHBCZUSXSQ-FYUUQPQTSA-N |
| XLogP | 0.25 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|