C15H18F3NO2S — CID 162412394
(4aR,7aR)-6-benzyl-7a-(trifluoromethyl)-2,3,4,4a,5,7-hexahydrothiopyrano[2,3-c]pyrrole 1,1-dioxide (PubChem CID 162412394) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is (4aR,7aR)-6-benzyl-7a-(trifluoromethyl)-2,3,4,4a,5,7-hexahydrothiopyrano[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (4aR,7aR)-6-benzyl-7a-(trifluoromethyl)-2,3,4,4a,5,7-hexahydrothiopyrano[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 162412394 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (4aR,7aR)-6-benzyl-7a-(trifluoromethyl)-2,3,4,4a,5,7-hexahydrothiopyrano[2,3-c]pyrrole 1,1-dioxide |
| SMILES | O=S1(=O)CCC[C@@H]2CN(Cc3ccccc3)C[C@@]21C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO2S/c16-15(17,18)14-11-19(9-12-5-2-1-3-6-12)10-13(14)7-4-8-22(14,20)21/h1-3,5-6,13H,4,7-11H2/t13-,14+/m1/s1 |
| InChIKey | OXFSODWMHQWCNH-KGLIPLIRSA-N |
| XLogP | 2.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |