C18H33NSi — CID 162412725
2-[(3aS,6R,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 162412725) has the molecular formula C18H33NSi and a molecular weight of 291.56 g/mol. Its IUPAC name is 2-[(3aS,6R,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(3aS,6R,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 162412725 |
| Molecular Formula | C18H33NSi |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 2-[(3aS,6R,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C[C@H]1CC[C@H]2CCN[C@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H33NSi/c1-13(2)20(14(3)4,15(5)6)12-10-17-8-7-16-9-11-19-18(16)17/h13-19H,7-9,11H2,1-6H3/t16-,17+,18+/m0/s1 |
| InChIKey | XVJVYZKVVWWPRQ-RCCFBDPRSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|