C17H22F3NO2 — CID 162413150
(3R,4S)-1-hexyl-3-methoxy-4-[4-(trifluoromethyl)phenyl]azetidin-2-one (PubChem CID 162413150) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (3R,4S)-1-hexyl-3-methoxy-4-[4-(trifluoromethyl)phenyl]azetidin-2-one.
| Compound Name | (3R,4S)-1-hexyl-3-methoxy-4-[4-(trifluoromethyl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 162413150 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3R,4S)-1-hexyl-3-methoxy-4-[4-(trifluoromethyl)phenyl]azetidin-2-one |
| SMILES | CCCCCCN1C(=O)[C@H](OC)[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO2/c1-3-4-5-6-11-21-14(15(23-2)16(21)22)12-7-9-13(10-8-12)17(18,19)20/h7-10,14-15H,3-6,11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | GZOZZWZBUJDCJU-LSDHHAIUSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|