C41H50FN4O+ — CID 162413381
1-[(S)-[1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(4-fluorophenyl)urea (PubChem CID 162413381) has the molecular formula C41H50FN4O+ and a molecular weight of 633.88 g/mol. Its IUPAC name is 1-[(S)-[1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(S)-[1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 162413381 |
| Molecular Formula | C41H50FN4O+ |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.40 |
| IUPAC Name | 1-[(S)-[1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(4-fluorophenyl)urea |
| SMILES | C=CC1C[N+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)CCC1CC2[C@@H](NC(=O)Nc1ccc(F)cc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C41H49FN4O/c1-8-28-26-46(25-27-21-30(40(2,3)4)24-31(22-27)41(5,6)7)20-18-29(28)23-37(46)38(35-17-19-43-36-12-10-9-11-34(35)36)45-39(47)44-33-15-13-32(42)14-16-33/h8-17,19,21-22,24,28-29,37-38H,1,18,20,23,25-26H2,2-7H3,(H-,44,45,47)/p+1/t28?,29?,37?,38-,46?/m0/s1 |
| InChIKey | YSGYYXSNSAIEFH-REJPZXKMSA-O |
| XLogP | 9.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|