C14H21NO4 — CID 162414012
tert-butyl N-[1-[(3R,5S)-5-ethenyl-2-oxooxolan-3-yl]prop-2-enyl]carbamate (PubChem CID 162414012) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl N-[1-[(3R,5S)-5-ethenyl-2-oxooxolan-3-yl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[(3R,5S)-5-ethenyl-2-oxooxolan-3-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 162414012 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl N-[1-[(3R,5S)-5-ethenyl-2-oxooxolan-3-yl]prop-2-enyl]carbamate |
| SMILES | C=CC(NC(=O)OC(C)(C)C)[C@H]1C[C@@H](C=C)OC1=O |
| InChI | InChI=1S/C14H21NO4/c1-6-9-8-10(12(16)18-9)11(7-2)15-13(17)19-14(3,4)5/h6-7,9-11H,1-2,8H2,3-5H3,(H,15,17)/t9-,10-,11?/m1/s1 |
| InChIKey | LAZQMERSBHSIKE-DIOIDXFWSA-N |
| XLogP | 2.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|