C13H21NO4 — CID 11391187
tert-butyl N-[(3S,4S,5S)-4-methyl-2-oxo-5-prop-1-en-2-yloxolan-3-yl]carbamate (PubChem CID 11391187) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S,5S)-4-methyl-2-oxo-5-prop-1-en-2-yloxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S,5S)-4-methyl-2-oxo-5-prop-1-en-2-yloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 11391187 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl N-[(3S,4S,5S)-4-methyl-2-oxo-5-prop-1-en-2-yloxolan-3-yl]carbamate |
| SMILES | C=C(C)[C@H]1OC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C13H21NO4/c1-7(2)10-8(3)9(11(15)17-10)14-12(16)18-13(4,5)6/h8-10H,1H2,2-6H3,(H,14,16)/t8-,9-,10+/m0/s1 |
| InChIKey | LUFAQBAHDBUUOA-LPEHRKFASA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|