C17H29NO4 — CID 10614969
[(3S)-6-methylhepta-1,6-dien-3-yl] (2S)-2-(ethoxycarbonylamino)-4-methylpentanoate (PubChem CID 10614969) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is [(3S)-6-methylhepta-1,6-dien-3-yl] (2S)-2-(ethoxycarbonylamino)-4-methylpentanoate.
| Compound Name | [(3S)-6-methylhepta-1,6-dien-3-yl] (2S)-2-(ethoxycarbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 10614969 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(3S)-6-methylhepta-1,6-dien-3-yl] (2S)-2-(ethoxycarbonylamino)-4-methylpentanoate |
| SMILES | C=C[C@H](CCC(=C)C)OC(=O)[C@H](CC(C)C)NC(=O)OCC |
| InChI | InChI=1S/C17H29NO4/c1-7-14(10-9-12(3)4)22-16(19)15(11-13(5)6)18-17(20)21-8-2/h7,13-15H,1,3,8-11H2,2,4-6H3,(H,18,20)/t14-,15+/m1/s1 |
| InChIKey | RXYGCBWRXNCVTD-CABCVRRESA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|