C23H30O3 — CID 162414266
9-ethoxy-3,3a,6,6a-tetramethyl-4,5,6,7,11b,11c-hexahydro-1H-benzo[a]phenalene-8,11-dione (PubChem CID 162414266) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 9-ethoxy-3,3a,6,6a-tetramethyl-4,5,6,7,11b,11c-hexahydro-1H-benzo[a]phenalene-8,11-dione.
| Compound Name | 9-ethoxy-3,3a,6,6a-tetramethyl-4,5,6,7,11b,11c-hexahydro-1H-benzo[a]phenalene-8,11-dione |
|---|---|
| PubChem CID | 162414266 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 9-ethoxy-3,3a,6,6a-tetramethyl-4,5,6,7,11b,11c-hexahydro-1H-benzo[a]phenalene-8,11-dione |
| SMILES | CCOC1=CC(=O)C2=C(CC3(C)C(C)CCC4(C)C(C)=CCC2C43)C1=O |
| InChI | InChI=1S/C23H30O3/c1-6-26-18-11-17(24)19-15-8-7-13(2)22(4)10-9-14(3)23(5,21(15)22)12-16(19)20(18)25/h7,11,14-15,21H,6,8-10,12H2,1-5H3 |
| InChIKey | CJXIOVJNKJUSCX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|