C21H24N2O2 — CID 162415487
3-[1-(4-methoxyphenyl)propyl]-1,6,7-trimethylquinoxalin-2-one (PubChem CID 162415487) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)propyl]-1,6,7-trimethylquinoxalin-2-one.
| Compound Name | 3-[1-(4-methoxyphenyl)propyl]-1,6,7-trimethylquinoxalin-2-one |
|---|---|
| PubChem CID | 162415487 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)propyl]-1,6,7-trimethylquinoxalin-2-one |
| SMILES | CCC(c1ccc(OC)cc1)c1nc2cc(C)c(C)cc2n(C)c1=O |
| InChI | InChI=1S/C21H24N2O2/c1-6-17(15-7-9-16(25-5)10-8-15)20-21(24)23(4)19-12-14(3)13(2)11-18(19)22-20/h7-12,17H,6H2,1-5H3 |
| InChIKey | CCQBAEYPILDFML-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |